C36H44N6O5S2 — CID 136500184
N-[5-[2-[[1-[4-[[2-(1-benzylpiperidin-4-yl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]piperidin-4-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide (PubChem CID 136500184) has the molecular formula C36H44N6O5S2 and a molecular weight of 704.92 g/mol. Its IUPAC name is N-[5-[2-[[1-[4-[[2-(1-benzylpiperidin-4-yl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]piperidin-4-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide.
| Compound Name | N-[5-[2-[[1-[4-[[2-(1-benzylpiperidin-4-yl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]piperidin-4-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 136500184 |
| Molecular Formula | C36H44N6O5S2 |
| Molecular Weight | 704.92 g/mol |
| Exact Mass | 704.28 |
| IUPAC Name | N-[5-[2-[[1-[4-[[2-(1-benzylpiperidin-4-yl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]piperidin-4-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(C(O)CNC2CCN(c3ccc(C=C4S/C(=N\C5CCN(Cc6ccccc6)CC5)NC4=O)cc3)CC2)ccc1O |
| InChI | InChI=1S/C36H44N6O5S2/c1-49(46,47)40-31-22-27(9-12-32(31)43)33(44)23-37-28-15-19-42(20-16-28)30-10-7-25(8-11-30)21-34-35(45)39-36(48-34)38-29-13-17-41(18-14-29)24-26-5-3-2-4-6-26/h2-12,21-22,28-29,33,37,40,43-44H,13-20,23-24H2,1H3,(H,38,39,45) |
| InChIKey | RYGZJWDFRONRKW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 146.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.92 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|