C36H48N4O8S2 — CID 174465620
[N-hept-1-en-3-ylsulfonyl-4-[4-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]piperidin-1-yl]anilino] 3-phenylpropanoate (PubChem CID 174465620) has the molecular formula C36H48N4O8S2 and a molecular weight of 728.93 g/mol. Its IUPAC name is [N-hept-1-en-3-ylsulfonyl-4-[4-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]piperidin-1-yl]anilino] 3-phenylpropanoate.
| Compound Name | [N-hept-1-en-3-ylsulfonyl-4-[4-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]piperidin-1-yl]anilino] 3-phenylpropanoate |
|---|---|
| PubChem CID | 174465620 |
| Molecular Formula | C36H48N4O8S2 |
| Molecular Weight | 728.93 g/mol |
| Exact Mass | 728.29 |
| IUPAC Name | [N-hept-1-en-3-ylsulfonyl-4-[4-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]piperidin-1-yl]anilino] 3-phenylpropanoate |
| SMILES | C=CC(CCCC)S(=O)(=O)N(OC(=O)CCc1ccccc1)c1ccc(N2CCC(NC[C@H](O)c3ccc(O)c(NS(C)(=O)=O)c3)CC2)cc1 |
| InChI | InChI=1S/C36H48N4O8S2/c1-4-6-12-32(5-2)50(46,47)40(48-36(43)20-13-27-10-8-7-9-11-27)31-17-15-30(16-18-31)39-23-21-29(22-24-39)37-26-35(42)28-14-19-34(41)33(25-28)38-49(3,44)45/h5,7-11,14-19,25,29,32,35,37-38,41-42H,2,4,6,12-13,20-24,26H2,1,3H3/t32?,35-/m0/s1 |
| InChIKey | HFUXSIUSNLKTJS-JXTSYGIPSA-N |
| XLogP | 5.03 |
| TPSA | 165.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.93 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|