C25H28N6O5S2 — CID 135430989
N-[5-[(1R)-2-[[1-[4-[(E)-(2-cyanoimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperidin-4-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide (PubChem CID 135430989) has the molecular formula C25H28N6O5S2 and a molecular weight of 556.67 g/mol. Its IUPAC name is N-[5-[(1R)-2-[[1-[4-[(E)-(2-cyanoimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperidin-4-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide.
| Compound Name | N-[5-[(1R)-2-[[1-[4-[(E)-(2-cyanoimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperidin-4-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 135430989 |
| Molecular Formula | C25H28N6O5S2 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | N-[5-[(1R)-2-[[1-[4-[(E)-(2-cyanoimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperidin-4-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc([C@@H](O)CNC2CCN(c3ccc(/C=C4/S/C(=N\C#N)NC4=O)cc3)CC2)ccc1O |
| InChI | InChI=1S/C25H28N6O5S2/c1-38(35,36)30-20-13-17(4-7-21(20)32)22(33)14-27-18-8-10-31(11-9-18)19-5-2-16(3-6-19)12-23-24(34)29-25(37-23)28-15-26/h2-7,12-13,18,22,27,30,32-33H,8-11,14H2,1H3,(H,28,29,34)/b23-12+/t22-/m0/s1 |
| InChIKey | HURVPTVUCFGPMY-HPARJBSBSA-N |
| XLogP | 2.10 |
| TPSA | 167.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|