C25H35N5O7S — CID 91452387
[[4-[4-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]piperidin-1-yl]phenyl]carbamoylamino] butanoate (PubChem CID 91452387) has the molecular formula C25H35N5O7S and a molecular weight of 549.65 g/mol. Its IUPAC name is [[4-[4-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]piperidin-1-yl]phenyl]carbamoylamino] butanoate.
| Compound Name | [[4-[4-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]piperidin-1-yl]phenyl]carbamoylamino] butanoate |
|---|---|
| PubChem CID | 91452387 |
| Molecular Formula | C25H35N5O7S |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | [[4-[4-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]piperidin-1-yl]phenyl]carbamoylamino] butanoate |
| SMILES | CCCC(=O)ONC(=O)Nc1ccc(N2CCC(NC[C@H](O)c3ccc(O)c(NS(C)(=O)=O)c3)CC2)cc1 |
| InChI | InChI=1S/C25H35N5O7S/c1-3-4-24(33)37-28-25(34)27-19-6-8-20(9-7-19)30-13-11-18(12-14-30)26-16-23(32)17-5-10-22(31)21(15-17)29-38(2,35)36/h5-10,15,18,23,26,29,31-32H,3-4,11-14,16H2,1-2H3,(H2,27,28,34)/t23-/m0/s1 |
| InChIKey | NRDXVYBVTPRHJM-QHCPKHFHSA-N |
| XLogP | 2.44 |
| TPSA | 169.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|