C25H34N4O7S — CID 70009803
ethyl 3-[4-[(2R)-2-[[2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]piperidin-1-yl]anilino]-3-oxopropanoate (PubChem CID 70009803) has the molecular formula C25H34N4O7S and a molecular weight of 534.64 g/mol. Its IUPAC name is ethyl 3-[4-[(2R)-2-[[2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]piperidin-1-yl]anilino]-3-oxopropanoate.
| Compound Name | ethyl 3-[4-[(2R)-2-[[2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]piperidin-1-yl]anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 70009803 |
| Molecular Formula | C25H34N4O7S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | ethyl 3-[4-[(2R)-2-[[2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]piperidin-1-yl]anilino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)Nc1ccc(N2CCCC[C@@H]2NCC(O)c2ccc(O)c(NS(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C25H34N4O7S/c1-3-36-25(33)15-24(32)27-18-8-10-19(11-9-18)29-13-5-4-6-23(29)26-16-22(31)17-7-12-21(30)20(14-17)28-37(2,34)35/h7-12,14,22-23,26,28,30-31H,3-6,13,15-16H2,1-2H3,(H,27,32)/t22?,23-/m1/s1 |
| InChIKey | KCLOGOIFRDNVRX-OZAIVSQSSA-N |
| XLogP | 2.30 |
| TPSA | 157.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|