C28H34N4O6S — CID 87937669
4-[4-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]piperidin-1-yl]-N-phenylmethoxybenzamide (PubChem CID 87937669) has the molecular formula C28H34N4O6S and a molecular weight of 554.67 g/mol. Its IUPAC name is 4-[4-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]piperidin-1-yl]-N-phenylmethoxybenzamide.
| Compound Name | 4-[4-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]piperidin-1-yl]-N-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 87937669 |
| Molecular Formula | C28H34N4O6S |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | 4-[4-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(methanesulfonamido)phenyl]ethyl]amino]piperidin-1-yl]-N-phenylmethoxybenzamide |
| SMILES | CS(=O)(=O)Nc1cc([C@H](O)CNC2CCN(c3ccc(C(=O)NOCc4ccccc4)cc3)CC2)ccc1O |
| InChI | InChI=1S/C28H34N4O6S/c1-39(36,37)31-25-17-22(9-12-26(25)33)27(34)18-29-23-13-15-32(16-14-23)24-10-7-21(8-11-24)28(35)30-38-19-20-5-3-2-4-6-20/h2-12,17,23,27,29,31,33-34H,13-16,18-19H2,1H3,(H,30,35)/t27-/m1/s1 |
| InChIKey | AGKISVNTRULADP-HHHXNRCGSA-N |
| XLogP | 2.92 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|