C31H41N3O6S — CID 159473669
1-hexyl-3-[4-[[4-[(5S)-5-hydroxy-6-(4-hydroxyphenoxy)hexyl]phenyl]sulfamoyl]phenyl]urea (PubChem CID 159473669) has the molecular formula C31H41N3O6S and a molecular weight of 583.75 g/mol. Its IUPAC name is 1-hexyl-3-[4-[[4-[(5S)-5-hydroxy-6-(4-hydroxyphenoxy)hexyl]phenyl]sulfamoyl]phenyl]urea.
| Compound Name | 1-hexyl-3-[4-[[4-[(5S)-5-hydroxy-6-(4-hydroxyphenoxy)hexyl]phenyl]sulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 159473669 |
| Molecular Formula | C31H41N3O6S |
| Molecular Weight | 583.75 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | 1-hexyl-3-[4-[[4-[(5S)-5-hydroxy-6-(4-hydroxyphenoxy)hexyl]phenyl]sulfamoyl]phenyl]urea |
| SMILES | CCCCCCNC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(CCCC[C@H](O)COc3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H41N3O6S/c1-2-3-4-7-22-32-31(37)33-25-14-20-30(21-15-25)41(38,39)34-26-12-10-24(11-13-26)8-5-6-9-28(36)23-40-29-18-16-27(35)17-19-29/h10-21,28,34-36H,2-9,22-23H2,1H3,(H2,32,33,37)/t28-/m0/s1 |
| InChIKey | XUVYJRVZPKOQRQ-NDEPHWFRSA-N |
| XLogP | 6.05 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.75 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|