C30H39ClN4O5S — CID 11204204
1-[4-[[3-chloro-4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]phenyl]sulfamoyl]phenyl]-3-hexylurea (PubChem CID 11204204) has the molecular formula C30H39ClN4O5S and a molecular weight of 603.19 g/mol. Its IUPAC name is 1-[4-[[3-chloro-4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]phenyl]sulfamoyl]phenyl]-3-hexylurea.
| Compound Name | 1-[4-[[3-chloro-4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]phenyl]sulfamoyl]phenyl]-3-hexylurea |
|---|---|
| PubChem CID | 11204204 |
| Molecular Formula | C30H39ClN4O5S |
| Molecular Weight | 603.19 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | 1-[4-[[3-chloro-4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]phenyl]sulfamoyl]phenyl]-3-hexylurea |
| SMILES | CCCCCCNC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(CCN[C@@H](C)[C@H](O)c3ccc(O)cc3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C30H39ClN4O5S/c1-3-4-5-6-18-33-30(38)34-24-11-15-27(16-12-24)41(39,40)35-25-10-7-22(28(31)20-25)17-19-32-21(2)29(37)23-8-13-26(36)14-9-23/h7-16,20-21,29,32,35-37H,3-6,17-19H2,1-2H3,(H2,33,34,38)/t21-,29-/m0/s1 |
| InChIKey | PJLUHFIEQKUQGS-LGGPFLRQSA-N |
| XLogP | 5.80 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.19 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|