C29H35N3O8S — CID 19385003
2-[[4-[[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenyl]sulfamoyl]phenyl]carbamoyl]pentanoic acid (PubChem CID 19385003) has the molecular formula C29H35N3O8S and a molecular weight of 585.68 g/mol. Its IUPAC name is 2-[[4-[[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenyl]sulfamoyl]phenyl]carbamoyl]pentanoic acid.
| Compound Name | 2-[[4-[[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenyl]sulfamoyl]phenyl]carbamoyl]pentanoic acid |
|---|---|
| PubChem CID | 19385003 |
| Molecular Formula | C29H35N3O8S |
| Molecular Weight | 585.68 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | 2-[[4-[[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenyl]sulfamoyl]phenyl]carbamoyl]pentanoic acid |
| SMILES | CCCC(C(=O)O)C(=O)Nc1ccc(S(=O)(=O)Nc2ccc(CCNCC(O)COc3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H35N3O8S/c1-2-3-27(29(36)37)28(35)31-21-8-14-26(15-9-21)41(38,39)32-22-6-4-20(5-7-22)16-17-30-18-24(34)19-40-25-12-10-23(33)11-13-25/h4-15,24,27,30,32-34H,2-3,16-19H2,1H3,(H,31,35)(H,36,37) |
| InChIKey | ZSQBZPUYNIKYRS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 174.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.68 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|