C24H31N3O6S — CID 10141154
4-[(2R)-3-[2-[4-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methylsulfonyl]phenyl]ethylamino]-2-hydroxypropoxy]phenol (PubChem CID 10141154) has the molecular formula C24H31N3O6S and a molecular weight of 489.59 g/mol. Its IUPAC name is 4-[(2R)-3-[2-[4-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methylsulfonyl]phenyl]ethylamino]-2-hydroxypropoxy]phenol.
| Compound Name | 4-[(2R)-3-[2-[4-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methylsulfonyl]phenyl]ethylamino]-2-hydroxypropoxy]phenol |
|---|---|
| PubChem CID | 10141154 |
| Molecular Formula | C24H31N3O6S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 4-[(2R)-3-[2-[4-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methylsulfonyl]phenyl]ethylamino]-2-hydroxypropoxy]phenol |
| SMILES | CC(C)(C)c1nc(CS(=O)(=O)c2ccc(CCNC[C@@H](O)COc3ccc(O)cc3)cc2)no1 |
| InChI | InChI=1S/C24H31N3O6S/c1-24(2,3)23-26-22(27-33-23)16-34(30,31)21-10-4-17(5-11-21)12-13-25-14-19(29)15-32-20-8-6-18(28)7-9-20/h4-11,19,25,28-29H,12-16H2,1-3H3/t19-/m1/s1 |
| InChIKey | AVDOIUVMKWQZEJ-LJQANCHMSA-N |
| XLogP | 2.62 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|