C24H31N3O4S — CID 18419567
4-[3-[2-[4-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]ethylamino]-2-hydroxypropoxy]phenol (PubChem CID 18419567) has the molecular formula C24H31N3O4S and a molecular weight of 457.60 g/mol. Its IUPAC name is 4-[3-[2-[4-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]ethylamino]-2-hydroxypropoxy]phenol.
| Compound Name | 4-[3-[2-[4-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]ethylamino]-2-hydroxypropoxy]phenol |
|---|---|
| PubChem CID | 18419567 |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 4-[3-[2-[4-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenyl]ethylamino]-2-hydroxypropoxy]phenol |
| SMILES | CC(C)(C)c1nc(CSc2ccc(CCNCC(O)COc3ccc(O)cc3)cc2)no1 |
| InChI | InChI=1S/C24H31N3O4S/c1-24(2,3)23-26-22(27-31-23)16-32-21-10-4-17(5-11-21)12-13-25-14-19(29)15-30-20-8-6-18(28)7-9-20/h4-11,19,25,28-29H,12-16H2,1-3H3 |
| InChIKey | GOKLVAMFDWAWNC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|