C32H47N5O5S — CID 10211100
1-[4-[4-[[[(2S)-2-hydroxy-3-(1H-indol-5-yloxy)propyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]-3-octylurea (PubChem CID 10211100) has the molecular formula C32H47N5O5S and a molecular weight of 613.83 g/mol. Its IUPAC name is 1-[4-[4-[[[(2S)-2-hydroxy-3-(1H-indol-5-yloxy)propyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]-3-octylurea.
| Compound Name | 1-[4-[4-[[[(2S)-2-hydroxy-3-(1H-indol-5-yloxy)propyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]-3-octylurea |
|---|---|
| PubChem CID | 10211100 |
| Molecular Formula | C32H47N5O5S |
| Molecular Weight | 613.83 g/mol |
| Exact Mass | 613.33 |
| IUPAC Name | 1-[4-[4-[[[(2S)-2-hydroxy-3-(1H-indol-5-yloxy)propyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]-3-octylurea |
| SMILES | CCCCCCCCNC(=O)Nc1ccc(S(=O)(=O)N2CCC(CNC[C@H](O)COc3ccc4[nH]ccc4c3)CC2)cc1 |
| InChI | InChI=1S/C32H47N5O5S/c1-2-3-4-5-6-7-17-35-32(39)36-27-8-11-30(12-9-27)43(40,41)37-19-15-25(16-20-37)22-33-23-28(38)24-42-29-10-13-31-26(21-29)14-18-34-31/h8-14,18,21,25,28,33-34,38H,2-7,15-17,19-20,22-24H2,1H3,(H2,35,36,39)/t28-/m0/s1 |
| InChIKey | NTAHQTDUNSDLJL-NDEPHWFRSA-N |
| XLogP | 5.08 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.83 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|