C21H27N3O7S — CID 70001665
4-[(2R)-2-hydroxy-3-[[1-(4-nitrophenyl)sulfonylpiperidin-4-yl]methylamino]propoxy]phenol (PubChem CID 70001665) has the molecular formula C21H27N3O7S and a molecular weight of 465.53 g/mol. Its IUPAC name is 4-[(2R)-2-hydroxy-3-[[1-(4-nitrophenyl)sulfonylpiperidin-4-yl]methylamino]propoxy]phenol.
| Compound Name | 4-[(2R)-2-hydroxy-3-[[1-(4-nitrophenyl)sulfonylpiperidin-4-yl]methylamino]propoxy]phenol |
|---|---|
| PubChem CID | 70001665 |
| Molecular Formula | C21H27N3O7S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 4-[(2R)-2-hydroxy-3-[[1-(4-nitrophenyl)sulfonylpiperidin-4-yl]methylamino]propoxy]phenol |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CCC(CNC[C@@H](O)COc3ccc(O)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H27N3O7S/c25-18-3-5-20(6-4-18)31-15-19(26)14-22-13-16-9-11-23(12-10-16)32(29,30)21-7-1-17(2-8-21)24(27)28/h1-8,16,19,22,25-26H,9-15H2/t19-/m1/s1 |
| InChIKey | ZQMMQNAVSYWDHI-LJQANCHMSA-N |
| XLogP | 1.73 |
| TPSA | 142.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|