C20H19FN4O3S — CID 43815390
N-[2-[(3-cyano-6-ethoxyquinolin-2-yl)amino]ethyl]-2-fluorobenzenesulfonamide (PubChem CID 43815390) has the molecular formula C20H19FN4O3S and a molecular weight of 414.46 g/mol. Its IUPAC name is N-[2-[(3-cyano-6-ethoxyquinolin-2-yl)amino]ethyl]-2-fluorobenzenesulfonamide.
| Compound Name | N-[2-[(3-cyano-6-ethoxyquinolin-2-yl)amino]ethyl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 43815390 |
| Molecular Formula | C20H19FN4O3S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[2-[(3-cyano-6-ethoxyquinolin-2-yl)amino]ethyl]-2-fluorobenzenesulfonamide |
| SMILES | CCOc1ccc2nc(NCCNS(=O)(=O)c3ccccc3F)c(C#N)cc2c1 |
| InChI | InChI=1S/C20H19FN4O3S/c1-2-28-16-7-8-18-14(12-16)11-15(13-22)20(25-18)23-9-10-24-29(26,27)19-6-4-3-5-17(19)21/h3-8,11-12,24H,2,9-10H2,1H3,(H,23,25) |
| InChIKey | DCFZCVMKQBFXGV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|