C18H23N5O2S — CID 3221564
1-[2-[(3-cyano-6-ethoxyquinolin-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea (PubChem CID 3221564) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 1-[2-[(3-cyano-6-ethoxyquinolin-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[2-[(3-cyano-6-ethoxyquinolin-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 3221564 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1-[2-[(3-cyano-6-ethoxyquinolin-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea |
| SMILES | CCOc1ccc2nc(NCCNC(=S)NCCOC)c(C#N)cc2c1 |
| InChI | InChI=1S/C18H23N5O2S/c1-3-25-15-4-5-16-13(11-15)10-14(12-19)17(23-16)20-6-7-21-18(26)22-8-9-24-2/h4-5,10-11H,3,6-9H2,1-2H3,(H,20,23)(H2,21,22,26) |
| InChIKey | JBDPJJLQZGVQLR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|