C17H22N5O2S+ — CID 7421160
1-[2-[(3-cyano-6-methoxyquinolin-1-ium-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea (PubChem CID 7421160) has the molecular formula C17H22N5O2S+ and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-[2-[(3-cyano-6-methoxyquinolin-1-ium-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[2-[(3-cyano-6-methoxyquinolin-1-ium-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 7421160 |
| Molecular Formula | C17H22N5O2S+ |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 1-[2-[(3-cyano-6-methoxyquinolin-1-ium-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)NCCNc1[nH+]c2ccc(OC)cc2cc1C#N |
| InChI | InChI=1S/C17H21N5O2S/c1-23-8-7-21-17(25)20-6-5-19-16-13(11-18)9-12-10-14(24-2)3-4-15(12)22-16/h3-4,9-10H,5-8H2,1-2H3,(H,19,22)(H2,20,21,25)/p+1 |
| InChIKey | SKEQQZLGAJXSSW-UHFFFAOYSA-O |
| XLogP | 1.06 |
| TPSA | 92.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|