C19H25N5O2S — CID 3221578
1-[2-[(3-cyano-6-ethoxyquinolin-2-yl)amino]ethyl]-3-(3-methoxypropyl)thiourea (PubChem CID 3221578) has the molecular formula C19H25N5O2S and a molecular weight of 387.51 g/mol. Its IUPAC name is 1-[2-[(3-cyano-6-ethoxyquinolin-2-yl)amino]ethyl]-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-[2-[(3-cyano-6-ethoxyquinolin-2-yl)amino]ethyl]-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 3221578 |
| Molecular Formula | C19H25N5O2S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 1-[2-[(3-cyano-6-ethoxyquinolin-2-yl)amino]ethyl]-3-(3-methoxypropyl)thiourea |
| SMILES | CCOc1ccc2nc(NCCNC(=S)NCCCOC)c(C#N)cc2c1 |
| InChI | InChI=1S/C19H25N5O2S/c1-3-26-16-5-6-17-14(12-16)11-15(13-20)18(24-17)21-8-9-23-19(27)22-7-4-10-25-2/h5-6,11-12H,3-4,7-10H2,1-2H3,(H,21,24)(H2,22,23,27) |
| InChIKey | YCZKXUUXYKELFC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|