C21H20FN5O2 — CID 43813688
1-[2-[(3-cyano-6-ethoxyquinolin-2-yl)amino]ethyl]-3-(4-fluorophenyl)urea (PubChem CID 43813688) has the molecular formula C21H20FN5O2 and a molecular weight of 393.42 g/mol. Its IUPAC name is 1-[2-[(3-cyano-6-ethoxyquinolin-2-yl)amino]ethyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[2-[(3-cyano-6-ethoxyquinolin-2-yl)amino]ethyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 43813688 |
| Molecular Formula | C21H20FN5O2 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 1-[2-[(3-cyano-6-ethoxyquinolin-2-yl)amino]ethyl]-3-(4-fluorophenyl)urea |
| SMILES | CCOc1ccc2nc(NCCNC(=O)Nc3ccc(F)cc3)c(C#N)cc2c1 |
| InChI | InChI=1S/C21H20FN5O2/c1-2-29-18-7-8-19-14(12-18)11-15(13-23)20(27-19)24-9-10-25-21(28)26-17-5-3-16(22)4-6-17/h3-8,11-12H,2,9-10H2,1H3,(H,24,27)(H2,25,26,28) |
| InChIKey | QUFJOHPNAHUAHB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|