C19H25N5OS — CID 3221575
1-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]-3-(3-methoxypropyl)thiourea (PubChem CID 3221575) has the molecular formula C19H25N5OS and a molecular weight of 371.51 g/mol. Its IUPAC name is 1-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 3221575 |
| Molecular Formula | C19H25N5OS |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 1-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]-3-(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)NCCNc1nc2cc(C)cc(C)c2cc1C#N |
| InChI | InChI=1S/C19H25N5OS/c1-13-9-14(2)16-11-15(12-20)18(24-17(16)10-13)21-6-7-23-19(26)22-5-4-8-25-3/h9-11H,4-8H2,1-3H3,(H,21,24)(H2,22,23,26) |
| InChIKey | PMMDMFAGRFABCV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|