C22H21N3O — CID 159003973
5,7-dimethyl-2-[(4-oxo-4-phenylbutyl)amino]quinoline-3-carbonitrile (PubChem CID 159003973) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is 5,7-dimethyl-2-[(4-oxo-4-phenylbutyl)amino]quinoline-3-carbonitrile.
| Compound Name | 5,7-dimethyl-2-[(4-oxo-4-phenylbutyl)amino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 159003973 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 5,7-dimethyl-2-[(4-oxo-4-phenylbutyl)amino]quinoline-3-carbonitrile |
| SMILES | Cc1cc(C)c2cc(C#N)c(NCCCC(=O)c3ccccc3)nc2c1 |
| InChI | InChI=1S/C22H21N3O/c1-15-11-16(2)19-13-18(14-23)22(25-20(19)12-15)24-10-6-9-21(26)17-7-4-3-5-8-17/h3-5,7-8,11-13H,6,9-10H2,1-2H3,(H,24,25) |
| InChIKey | KHOGGSQTJVNHCO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|