C21H19BrN4O — CID 44754479
2-bromo-N-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]benzamide (PubChem CID 44754479) has the molecular formula C21H19BrN4O and a molecular weight of 423.31 g/mol. Its IUPAC name is 2-bromo-N-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]benzamide.
| Compound Name | 2-bromo-N-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 44754479 |
| Molecular Formula | C21H19BrN4O |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 2-bromo-N-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]benzamide |
| SMILES | Cc1cc(C)c2nc(NCCNC(=O)c3ccccc3Br)c(C#N)cc2c1 |
| InChI | InChI=1S/C21H19BrN4O/c1-13-9-14(2)19-15(10-13)11-16(12-23)20(26-19)24-7-8-25-21(27)17-5-3-4-6-18(17)22/h3-6,9-11H,7-8H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | VXYRTNMCDRXTGQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|