C21H26N4O — CID 3217041
N-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]cyclohexanecarboxamide (PubChem CID 3217041) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is N-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 3217041 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | N-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]cyclohexanecarboxamide |
| SMILES | Cc1cc(C)c2nc(NCCNC(=O)C3CCCCC3)c(C#N)cc2c1 |
| InChI | InChI=1S/C21H26N4O/c1-14-10-15(2)19-17(11-14)12-18(13-22)20(25-19)23-8-9-24-21(26)16-6-4-3-5-7-16/h10-12,16H,3-9H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | VXZAKHDBCDMYRB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|