C24H27N5S — CID 43815313
1-[3-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]propyl]-3-(2,3-dimethylphenyl)thiourea (PubChem CID 43815313) has the molecular formula C24H27N5S and a molecular weight of 417.58 g/mol. Its IUPAC name is 1-[3-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]propyl]-3-(2,3-dimethylphenyl)thiourea.
| Compound Name | 1-[3-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]propyl]-3-(2,3-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 43815313 |
| Molecular Formula | C24H27N5S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 1-[3-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]propyl]-3-(2,3-dimethylphenyl)thiourea |
| SMILES | Cc1cc(C)c2nc(NCCCNC(=S)Nc3cccc(C)c3C)c(C#N)cc2c1 |
| InChI | InChI=1S/C24H27N5S/c1-15-11-17(3)22-19(12-15)13-20(14-25)23(29-22)26-9-6-10-27-24(30)28-21-8-5-7-16(2)18(21)4/h5,7-8,11-13H,6,9-10H2,1-4H3,(H,26,29)(H2,27,28,30) |
| InChIKey | VFNUNINYRRPANH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 72.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|