C21H18F2N4O — CID 3297060
N-[3-[(3-cyano-8-methylquinolin-2-yl)amino]propyl]-2,6-difluorobenzamide (PubChem CID 3297060) has the molecular formula C21H18F2N4O and a molecular weight of 380.40 g/mol. Its IUPAC name is N-[3-[(3-cyano-8-methylquinolin-2-yl)amino]propyl]-2,6-difluorobenzamide.
| Compound Name | N-[3-[(3-cyano-8-methylquinolin-2-yl)amino]propyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 3297060 |
| Molecular Formula | C21H18F2N4O |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N-[3-[(3-cyano-8-methylquinolin-2-yl)amino]propyl]-2,6-difluorobenzamide |
| SMILES | Cc1cccc2cc(C#N)c(NCCCNC(=O)c3c(F)cccc3F)nc12 |
| InChI | InChI=1S/C21H18F2N4O/c1-13-5-2-6-14-11-15(12-24)20(27-19(13)14)25-9-4-10-26-21(28)18-16(22)7-3-8-17(18)23/h2-3,5-8,11H,4,9-10H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | RRZKSJMOSVUJKP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|