C12H11N3 — CID 84619490
8-methyl-2-(methylamino)quinoline-3-carbonitrile (PubChem CID 84619490) has the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. Its IUPAC name is 8-methyl-2-(methylamino)quinoline-3-carbonitrile.
| Compound Name | 8-methyl-2-(methylamino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 84619490 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 8-methyl-2-(methylamino)quinoline-3-carbonitrile |
| SMILES | CNc1nc2c(C)cccc2cc1C#N |
| InChI | InChI=1S/C12H11N3/c1-8-4-3-5-9-6-10(7-13)12(14-2)15-11(8)9/h3-6H,1-2H3,(H,14,15) |
| InChIKey | KNPCJRWXEWTXKV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |