C18H16N4O2 — CID 3513318
N-[2-[(3-cyano-8-methylquinolin-2-yl)amino]ethyl]furan-2-carboxamide (PubChem CID 3513318) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is N-[2-[(3-cyano-8-methylquinolin-2-yl)amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[(3-cyano-8-methylquinolin-2-yl)amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3513318 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-[2-[(3-cyano-8-methylquinolin-2-yl)amino]ethyl]furan-2-carboxamide |
| SMILES | Cc1cccc2cc(C#N)c(NCCNC(=O)c3ccco3)nc12 |
| InChI | InChI=1S/C18H16N4O2/c1-12-4-2-5-13-10-14(11-19)17(22-16(12)13)20-7-8-21-18(23)15-6-3-9-24-15/h2-6,9-10H,7-8H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | UQJNHISCAINRQH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|