C19H23N5OS — CID 51685218
1-[2-[(3-cyano-8-methylquinolin-2-yl)amino]ethyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 51685218) has the molecular formula C19H23N5OS and a molecular weight of 369.49 g/mol. Its IUPAC name is 1-[2-[(3-cyano-8-methylquinolin-2-yl)amino]ethyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[2-[(3-cyano-8-methylquinolin-2-yl)amino]ethyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 51685218 |
| Molecular Formula | C19H23N5OS |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 1-[2-[(3-cyano-8-methylquinolin-2-yl)amino]ethyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | Cc1cccc2cc(C#N)c(NCCNC(=S)NC[C@H]3CCCO3)nc12 |
| InChI | InChI=1S/C19H23N5OS/c1-13-4-2-5-14-10-15(11-20)18(24-17(13)14)21-7-8-22-19(26)23-12-16-6-3-9-25-16/h2,4-5,10,16H,3,6-9,12H2,1H3,(H,21,24)(H2,22,23,26)/t16-/m1/s1 |
| InChIKey | MWCMSOPDVQVFFZ-MRXNPFEDSA-N |
| XLogP | 2.47 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|