C16H23N3O2S — CID 8790889
N-(2,6-dimethylphenyl)-2-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]acetamide (PubChem CID 8790889) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]acetamide |
|---|---|
| PubChem CID | 8790889 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[[(2S)-oxolan-2-yl]methylcarbamothioylamino]acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CNC(=S)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C16H23N3O2S/c1-11-5-3-6-12(2)15(11)19-14(20)10-18-16(22)17-9-13-7-4-8-21-13/h3,5-6,13H,4,7-10H2,1-2H3,(H,19,20)(H2,17,18,22)/t13-/m0/s1 |
| InChIKey | YTXKVSIWBXGPLO-ZDUSSCGKSA-N |
| XLogP | 1.89 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|