C14H18BrN3O2S — CID 8788462
N-(2-bromophenyl)-2-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]acetamide (PubChem CID 8788462) has the molecular formula C14H18BrN3O2S and a molecular weight of 372.29 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]acetamide.
| Compound Name | N-(2-bromophenyl)-2-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]acetamide |
|---|---|
| PubChem CID | 8788462 |
| Molecular Formula | C14H18BrN3O2S |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | N-(2-bromophenyl)-2-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]acetamide |
| SMILES | O=C(CNC(=S)NC[C@H]1CCCO1)Nc1ccccc1Br |
| InChI | InChI=1S/C14H18BrN3O2S/c15-11-5-1-2-6-12(11)18-13(19)9-17-14(21)16-8-10-4-3-7-20-10/h1-2,5-6,10H,3-4,7-9H2,(H,18,19)(H2,16,17,21)/t10-/m1/s1 |
| InChIKey | MSYPDWLPZQHSNE-SNVBAGLBSA-N |
| XLogP | 2.03 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|