C12H14BrN3OS — CID 8788464
N-(2-bromophenyl)-2-(cyclopropylcarbamothioylamino)acetamide (PubChem CID 8788464) has the molecular formula C12H14BrN3OS and a molecular weight of 328.24 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-(cyclopropylcarbamothioylamino)acetamide.
| Compound Name | N-(2-bromophenyl)-2-(cyclopropylcarbamothioylamino)acetamide |
|---|---|
| PubChem CID | 8788464 |
| Molecular Formula | C12H14BrN3OS |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | N-(2-bromophenyl)-2-(cyclopropylcarbamothioylamino)acetamide |
| SMILES | O=C(CNC(=S)NC1CC1)Nc1ccccc1Br |
| InChI | InChI=1S/C12H14BrN3OS/c13-9-3-1-2-4-10(9)16-11(17)7-14-12(18)15-8-5-6-8/h1-4,8H,5-7H2,(H,16,17)(H2,14,15,18) |
| InChIKey | UTDNSOMLSQVXAS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|