C16H22BrN3OS — CID 8788475
N-(2-bromophenyl)-2-[[(1S,2R)-2-methylcyclohexyl]carbamothioylamino]acetamide (PubChem CID 8788475) has the molecular formula C16H22BrN3OS and a molecular weight of 384.34 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-[[(1S,2R)-2-methylcyclohexyl]carbamothioylamino]acetamide.
| Compound Name | N-(2-bromophenyl)-2-[[(1S,2R)-2-methylcyclohexyl]carbamothioylamino]acetamide |
|---|---|
| PubChem CID | 8788475 |
| Molecular Formula | C16H22BrN3OS |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | N-(2-bromophenyl)-2-[[(1S,2R)-2-methylcyclohexyl]carbamothioylamino]acetamide |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=S)NCC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C16H22BrN3OS/c1-11-6-2-4-8-13(11)20-16(22)18-10-15(21)19-14-9-5-3-7-12(14)17/h3,5,7,9,11,13H,2,4,6,8,10H2,1H3,(H,19,21)(H2,18,20,22)/t11-,13+/m1/s1 |
| InChIKey | ALXDIBQGPJPDLT-YPMHNXCESA-N |
| XLogP | 3.43 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|