C19H29N3OS — CID 11930832
2-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 11930832) has the molecular formula C19H29N3OS and a molecular weight of 347.53 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 11930832 |
| Molecular Formula | C19H29N3OS |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 2-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=S)N[C@@H]2CCCC[C@H]2C)c(C)c1 |
| InChI | InChI=1S/C19H29N3OS/c1-12-9-14(3)18(15(4)10-12)22-17(23)11-20-19(24)21-16-8-6-5-7-13(16)2/h9-10,13,16H,5-8,11H2,1-4H3,(H,22,23)(H2,20,21,24)/t13-,16-/m1/s1 |
| InChIKey | YXGAJVGNVVJZGM-CZUORRHYSA-N |
| XLogP | 3.59 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|