C17H24N2OS — CID 54786405
2-cyclopentyl-N-[(2,4,6-trimethylphenyl)carbamothioyl]acetamide (PubChem CID 54786405) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is 2-cyclopentyl-N-[(2,4,6-trimethylphenyl)carbamothioyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[(2,4,6-trimethylphenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 54786405 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-cyclopentyl-N-[(2,4,6-trimethylphenyl)carbamothioyl]acetamide |
| SMILES | Cc1cc(C)c(NC(=S)NC(=O)CC2CCCC2)c(C)c1 |
| InChI | InChI=1S/C17H24N2OS/c1-11-8-12(2)16(13(3)9-11)19-17(21)18-15(20)10-14-6-4-5-7-14/h8-9,14H,4-7,10H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | AZAZBHUNEOZCET-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|