C20H28N2O2S — CID 40560348
2-[(1R,3S)-3-acetyl-2,2-dimethylcyclobutyl]-N-[(2,4,6-trimethylphenyl)carbamothioyl]acetamide (PubChem CID 40560348) has the molecular formula C20H28N2O2S and a molecular weight of 360.52 g/mol. Its IUPAC name is 2-[(1R,3S)-3-acetyl-2,2-dimethylcyclobutyl]-N-[(2,4,6-trimethylphenyl)carbamothioyl]acetamide.
| Compound Name | 2-[(1R,3S)-3-acetyl-2,2-dimethylcyclobutyl]-N-[(2,4,6-trimethylphenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 40560348 |
| Molecular Formula | C20H28N2O2S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 2-[(1R,3S)-3-acetyl-2,2-dimethylcyclobutyl]-N-[(2,4,6-trimethylphenyl)carbamothioyl]acetamide |
| SMILES | CC(=O)[C@H]1C[C@H](CC(=O)NC(=S)Nc2c(C)cc(C)cc2C)C1(C)C |
| InChI | InChI=1S/C20H28N2O2S/c1-11-7-12(2)18(13(3)8-11)22-19(25)21-17(24)10-15-9-16(14(4)23)20(15,5)6/h7-8,15-16H,9-10H2,1-6H3,(H2,21,22,24,25)/t15-,16-/m1/s1 |
| InChIKey | QVBNSYIGXTYOSR-HZPDHXFCSA-N |
| XLogP | 4.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|