C12H15BrN2OS — CID 823759
N-[(4-bromo-2,6-dimethylphenyl)carbamothioyl]propanamide (PubChem CID 823759) has the molecular formula C12H15BrN2OS and a molecular weight of 315.24 g/mol. Its IUPAC name is N-[(4-bromo-2,6-dimethylphenyl)carbamothioyl]propanamide.
| Compound Name | N-[(4-bromo-2,6-dimethylphenyl)carbamothioyl]propanamide |
|---|---|
| PubChem CID | 823759 |
| Molecular Formula | C12H15BrN2OS |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | N-[(4-bromo-2,6-dimethylphenyl)carbamothioyl]propanamide |
| SMILES | CCC(=O)NC(=S)Nc1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C12H15BrN2OS/c1-4-10(16)14-12(17)15-11-7(2)5-9(13)6-8(11)3/h5-6H,4H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | PFCJNJMITFTBIJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|