C14H21BrN2S — CID 100563628
1-(4-bromo-2,6-dimethylphenyl)-3-(3-methylbutyl)thiourea (PubChem CID 100563628) has the molecular formula C14H21BrN2S and a molecular weight of 329.31 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dimethylphenyl)-3-(3-methylbutyl)thiourea.
| Compound Name | 1-(4-bromo-2,6-dimethylphenyl)-3-(3-methylbutyl)thiourea |
|---|---|
| PubChem CID | 100563628 |
| Molecular Formula | C14H21BrN2S |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 1-(4-bromo-2,6-dimethylphenyl)-3-(3-methylbutyl)thiourea |
| SMILES | Cc1cc(Br)cc(C)c1NC(=S)NCCC(C)C |
| InChI | InChI=1S/C14H21BrN2S/c1-9(2)5-6-16-14(18)17-13-10(3)7-12(15)8-11(13)4/h7-9H,5-6H2,1-4H3,(H2,16,17,18) |
| InChIKey | CAKIAVOWUUFNAD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|