C17H28BrN — CID 63448812
4-bromo-N-(2,6-dimethylheptan-4-yl)-2,6-dimethylaniline (PubChem CID 63448812) has the molecular formula C17H28BrN and a molecular weight of 326.32 g/mol. Its IUPAC name is 4-bromo-N-(2,6-dimethylheptan-4-yl)-2,6-dimethylaniline.
| Compound Name | 4-bromo-N-(2,6-dimethylheptan-4-yl)-2,6-dimethylaniline |
|---|---|
| PubChem CID | 63448812 |
| Molecular Formula | C17H28BrN |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 4-bromo-N-(2,6-dimethylheptan-4-yl)-2,6-dimethylaniline |
| SMILES | Cc1cc(Br)cc(C)c1NC(CC(C)C)CC(C)C |
| InChI | InChI=1S/C17H28BrN/c1-11(2)7-16(8-12(3)4)19-17-13(5)9-15(18)10-14(17)6/h9-12,16,19H,7-8H2,1-6H3 |
| InChIKey | BHWIONHOSKWNGL-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |