C16H26BrN — CID 55191771
4-bromo-2,6-dimethyl-N-(5-methylheptan-3-yl)aniline (PubChem CID 55191771) has the molecular formula C16H26BrN and a molecular weight of 312.30 g/mol. Its IUPAC name is 4-bromo-2,6-dimethyl-N-(5-methylheptan-3-yl)aniline.
| Compound Name | 4-bromo-2,6-dimethyl-N-(5-methylheptan-3-yl)aniline |
|---|---|
| PubChem CID | 55191771 |
| Molecular Formula | C16H26BrN |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 4-bromo-2,6-dimethyl-N-(5-methylheptan-3-yl)aniline |
| SMILES | CCC(C)CC(CC)Nc1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C16H26BrN/c1-6-11(3)8-15(7-2)18-16-12(4)9-14(17)10-13(16)5/h9-11,15,18H,6-8H2,1-5H3 |
| InChIKey | UTWBXKLBXFADLD-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |