C15H21BrClF2NO — CID 63432835
3-bromo-5-chloro-2-(difluoromethoxy)-N-(5-methylheptan-3-yl)aniline (PubChem CID 63432835) has the molecular formula C15H21BrClF2NO and a molecular weight of 384.69 g/mol. Its IUPAC name is 3-bromo-5-chloro-2-(difluoromethoxy)-N-(5-methylheptan-3-yl)aniline.
| Compound Name | 3-bromo-5-chloro-2-(difluoromethoxy)-N-(5-methylheptan-3-yl)aniline |
|---|---|
| PubChem CID | 63432835 |
| Molecular Formula | C15H21BrClF2NO |
| Molecular Weight | 384.69 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 3-bromo-5-chloro-2-(difluoromethoxy)-N-(5-methylheptan-3-yl)aniline |
| SMILES | CCC(C)CC(CC)Nc1cc(Cl)cc(Br)c1OC(F)F |
| InChI | InChI=1S/C15H21BrClF2NO/c1-4-9(3)6-11(5-2)20-13-8-10(17)7-12(16)14(13)21-15(18)19/h7-9,11,15,20H,4-6H2,1-3H3 |
| InChIKey | GDIPZWKWBCCBLL-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.69 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |