C14H19BrClF2NO — CID 63947321
3-bromo-5-chloro-2-(difluoromethoxy)-N-heptan-3-ylaniline (PubChem CID 63947321) has the molecular formula C14H19BrClF2NO and a molecular weight of 370.67 g/mol. Its IUPAC name is 3-bromo-5-chloro-2-(difluoromethoxy)-N-heptan-3-ylaniline.
| Compound Name | 3-bromo-5-chloro-2-(difluoromethoxy)-N-heptan-3-ylaniline |
|---|---|
| PubChem CID | 63947321 |
| Molecular Formula | C14H19BrClF2NO |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 3-bromo-5-chloro-2-(difluoromethoxy)-N-heptan-3-ylaniline |
| SMILES | CCCCC(CC)Nc1cc(Cl)cc(Br)c1OC(F)F |
| InChI | InChI=1S/C14H19BrClF2NO/c1-3-5-6-10(4-2)19-12-8-9(16)7-11(15)13(12)20-14(17)18/h7-8,10,14,19H,3-6H2,1-2H3 |
| InChIKey | KGYSLFZYHZGUDS-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |