C10H8Br2ClF2NO2 — CID 107903695
2-bromo-N-[3-bromo-5-chloro-2-(difluoromethoxy)phenyl]propanamide (PubChem CID 107903695) has the molecular formula C10H8Br2ClF2NO2 and a molecular weight of 407.44 g/mol. Its IUPAC name is 2-bromo-N-[3-bromo-5-chloro-2-(difluoromethoxy)phenyl]propanamide.
| Compound Name | 2-bromo-N-[3-bromo-5-chloro-2-(difluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 107903695 |
| Molecular Formula | C10H8Br2ClF2NO2 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 404.86 |
| IUPAC Name | 2-bromo-N-[3-bromo-5-chloro-2-(difluoromethoxy)phenyl]propanamide |
| SMILES | CC(Br)C(=O)Nc1cc(Cl)cc(Br)c1OC(F)F |
| InChI | InChI=1S/C10H8Br2ClF2NO2/c1-4(11)9(17)16-7-3-5(13)2-6(12)8(7)18-10(14)15/h2-4,10H,1H3,(H,16,17) |
| InChIKey | BZNUBECWMSWUIT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|