C19H17BrClF2NO5 — CID 16613980
(E)-N-[3-bromo-5-chloro-2-(difluoromethoxy)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 16613980) has the molecular formula C19H17BrClF2NO5 and a molecular weight of 492.70 g/mol. Its IUPAC name is (E)-N-[3-bromo-5-chloro-2-(difluoromethoxy)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-bromo-5-chloro-2-(difluoromethoxy)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 16613980 |
| Molecular Formula | C19H17BrClF2NO5 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 490.99 |
| IUPAC Name | (E)-N-[3-bromo-5-chloro-2-(difluoromethoxy)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cc(Cl)cc(Br)c2OC(F)F)cc(OC)c1OC |
| InChI | InChI=1S/C19H17BrClF2NO5/c1-26-14-6-10(7-15(27-2)18(14)28-3)4-5-16(25)24-13-9-11(21)8-12(20)17(13)29-19(22)23/h4-9,19H,1-3H3,(H,24,25)/b5-4+ |
| InChIKey | AREUFGKAEDPQEQ-SNAWJCMRSA-N |
| XLogP | 5.38 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|