C14H9BrClF2NO3S — CID 18153355
5-acetyl-N-[3-bromo-5-chloro-2-(difluoromethoxy)phenyl]thiophene-2-carboxamide (PubChem CID 18153355) has the molecular formula C14H9BrClF2NO3S and a molecular weight of 424.65 g/mol. Its IUPAC name is 5-acetyl-N-[3-bromo-5-chloro-2-(difluoromethoxy)phenyl]thiophene-2-carboxamide.
| Compound Name | 5-acetyl-N-[3-bromo-5-chloro-2-(difluoromethoxy)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18153355 |
| Molecular Formula | C14H9BrClF2NO3S |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 422.91 |
| IUPAC Name | 5-acetyl-N-[3-bromo-5-chloro-2-(difluoromethoxy)phenyl]thiophene-2-carboxamide |
| SMILES | CC(=O)c1ccc(C(=O)Nc2cc(Cl)cc(Br)c2OC(F)F)s1 |
| InChI | InChI=1S/C14H9BrClF2NO3S/c1-6(20)10-2-3-11(23-10)13(21)19-9-5-7(16)4-8(15)12(9)22-14(17)18/h2-5,14H,1H3,(H,19,21) |
| InChIKey | AJFDYQWBLCJDMB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |