C14H20BrF2N — CID 43347573
2-bromo-4,6-difluoro-N-(5-methylheptan-3-yl)aniline (PubChem CID 43347573) has the molecular formula C14H20BrF2N and a molecular weight of 320.22 g/mol. Its IUPAC name is 2-bromo-4,6-difluoro-N-(5-methylheptan-3-yl)aniline.
| Compound Name | 2-bromo-4,6-difluoro-N-(5-methylheptan-3-yl)aniline |
|---|---|
| PubChem CID | 43347573 |
| Molecular Formula | C14H20BrF2N |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-bromo-4,6-difluoro-N-(5-methylheptan-3-yl)aniline |
| SMILES | CCC(C)CC(CC)Nc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C14H20BrF2N/c1-4-9(3)6-11(5-2)18-14-12(15)7-10(16)8-13(14)17/h7-9,11,18H,4-6H2,1-3H3 |
| InChIKey | DYSLQTBWXHJJND-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |