C12H15BrF2N2O — CID 43347728
2-(2-bromo-4,6-difluoroanilino)-N-propan-2-ylpropanamide (PubChem CID 43347728) has the molecular formula C12H15BrF2N2O and a molecular weight of 321.17 g/mol. Its IUPAC name is 2-(2-bromo-4,6-difluoroanilino)-N-propan-2-ylpropanamide.
| Compound Name | 2-(2-bromo-4,6-difluoroanilino)-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 43347728 |
| Molecular Formula | C12H15BrF2N2O |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 2-(2-bromo-4,6-difluoroanilino)-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)C(C)Nc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C12H15BrF2N2O/c1-6(2)16-12(18)7(3)17-11-9(13)4-8(14)5-10(11)15/h4-7,17H,1-3H3,(H,16,18) |
| InChIKey | MLBPISKVZORWJZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |