C15H23Br2N — CID 55199601
2,6-dibromo-4-methyl-N-(5-methylheptan-3-yl)aniline (PubChem CID 55199601) has the molecular formula C15H23Br2N and a molecular weight of 377.16 g/mol. Its IUPAC name is 2,6-dibromo-4-methyl-N-(5-methylheptan-3-yl)aniline.
| Compound Name | 2,6-dibromo-4-methyl-N-(5-methylheptan-3-yl)aniline |
|---|---|
| PubChem CID | 55199601 |
| Molecular Formula | C15H23Br2N |
| Molecular Weight | 377.16 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 2,6-dibromo-4-methyl-N-(5-methylheptan-3-yl)aniline |
| SMILES | CCC(C)CC(CC)Nc1c(Br)cc(C)cc1Br |
| InChI | InChI=1S/C15H23Br2N/c1-5-10(3)7-12(6-2)18-15-13(16)8-11(4)9-14(15)17/h8-10,12,18H,5-7H2,1-4H3 |
| InChIKey | ILXZLTIKACBUEQ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.16 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |