C15H21ClN2S — CID 43674821
5-chloro-N-(5-methylheptan-3-yl)-1,3-benzothiazol-4-amine (PubChem CID 43674821) has the molecular formula C15H21ClN2S and a molecular weight of 296.87 g/mol. Its IUPAC name is 5-chloro-N-(5-methylheptan-3-yl)-1,3-benzothiazol-4-amine.
| Compound Name | 5-chloro-N-(5-methylheptan-3-yl)-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 43674821 |
| Molecular Formula | C15H21ClN2S |
| Molecular Weight | 296.87 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 5-chloro-N-(5-methylheptan-3-yl)-1,3-benzothiazol-4-amine |
| SMILES | CCC(C)CC(CC)Nc1c(Cl)ccc2scnc12 |
| InChI | InChI=1S/C15H21ClN2S/c1-4-10(3)8-11(5-2)18-14-12(16)6-7-13-15(14)17-9-19-13/h6-7,9-11,18H,4-5,8H2,1-3H3 |
| InChIKey | ZVKYRIJJSSSNSH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.87 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |