C15H12ClFN2OS — CID 107714756
4-[1-[(5-chloro-1,3-benzothiazol-4-yl)amino]ethyl]-3-fluorophenol (PubChem CID 107714756) has the molecular formula C15H12ClFN2OS and a molecular weight of 322.79 g/mol. Its IUPAC name is 4-[1-[(5-chloro-1,3-benzothiazol-4-yl)amino]ethyl]-3-fluorophenol.
| Compound Name | 4-[1-[(5-chloro-1,3-benzothiazol-4-yl)amino]ethyl]-3-fluorophenol |
|---|---|
| PubChem CID | 107714756 |
| Molecular Formula | C15H12ClFN2OS |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 4-[1-[(5-chloro-1,3-benzothiazol-4-yl)amino]ethyl]-3-fluorophenol |
| SMILES | CC(Nc1c(Cl)ccc2scnc12)c1ccc(O)cc1F |
| InChI | InChI=1S/C15H12ClFN2OS/c1-8(10-3-2-9(20)6-12(10)17)19-14-11(16)4-5-13-15(14)18-7-21-13/h2-8,19-20H,1H3 |
| InChIKey | NICLMICBRIXSIS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |