C14H11Cl3FNO — CID 107714699
3-fluoro-4-[1-(2,4,6-trichloroanilino)ethyl]phenol (PubChem CID 107714699) has the molecular formula C14H11Cl3FNO and a molecular weight of 334.61 g/mol. Its IUPAC name is 3-fluoro-4-[1-(2,4,6-trichloroanilino)ethyl]phenol.
| Compound Name | 3-fluoro-4-[1-(2,4,6-trichloroanilino)ethyl]phenol |
|---|---|
| PubChem CID | 107714699 |
| Molecular Formula | C14H11Cl3FNO |
| Molecular Weight | 334.61 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | 3-fluoro-4-[1-(2,4,6-trichloroanilino)ethyl]phenol |
| SMILES | CC(Nc1c(Cl)cc(Cl)cc1Cl)c1ccc(O)cc1F |
| InChI | InChI=1S/C14H11Cl3FNO/c1-7(10-3-2-9(20)6-13(10)18)19-14-11(16)4-8(15)5-12(14)17/h2-7,19-20H,1H3 |
| InChIKey | SDUWUBUFSZSWKV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |