C14H11Cl2F2NO — CID 83077307
2-[1-(2,6-dichloro-4-fluoroanilino)ethyl]-4-fluorophenol (PubChem CID 83077307) has the molecular formula C14H11Cl2F2NO and a molecular weight of 318.15 g/mol. Its IUPAC name is 2-[1-(2,6-dichloro-4-fluoroanilino)ethyl]-4-fluorophenol.
| Compound Name | 2-[1-(2,6-dichloro-4-fluoroanilino)ethyl]-4-fluorophenol |
|---|---|
| PubChem CID | 83077307 |
| Molecular Formula | C14H11Cl2F2NO |
| Molecular Weight | 318.15 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 2-[1-(2,6-dichloro-4-fluoroanilino)ethyl]-4-fluorophenol |
| SMILES | CC(Nc1c(Cl)cc(F)cc1Cl)c1cc(F)ccc1O |
| InChI | InChI=1S/C14H11Cl2F2NO/c1-7(10-4-8(17)2-3-13(10)20)19-14-11(15)5-9(18)6-12(14)16/h2-7,19-20H,1H3 |
| InChIKey | CGUVRRVOZOCNLO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.15 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|